C9H14F7N — CID 90760291
N-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-methylpentan-1-amine (PubChem CID 90760291) has the molecular formula C9H14F7N and a molecular weight of 269.20 g/mol. Its IUPAC name is N-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-methylpentan-1-amine.
| Compound Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 90760291 |
| Molecular Formula | C9H14F7N |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-methylpentan-1-amine |
| SMILES | CCC(C)CCNC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F7N/c1-3-6(2)4-5-17-7(10,8(11,12)13)9(14,15)16/h6,17H,3-5H2,1-2H3 |
| InChIKey | YZMKYFJNWBQLPX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|