C21H29N3 — CID 90761336
4-[2-(2-cyclohexylidenehydrazinyl)-2-phenylethyl]-N,N-dimethylcyclopenta-1,4-dien-1-amine (PubChem CID 90761336) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-[2-(2-cyclohexylidenehydrazinyl)-2-phenylethyl]-N,N-dimethylcyclopenta-1,4-dien-1-amine.
| Compound Name | 4-[2-(2-cyclohexylidenehydrazinyl)-2-phenylethyl]-N,N-dimethylcyclopenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 90761336 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 4-[2-(2-cyclohexylidenehydrazinyl)-2-phenylethyl]-N,N-dimethylcyclopenta-1,4-dien-1-amine |
| SMILES | CN(C)C1=CCC(CC(NN=C2CCCCC2)c2ccccc2)=C1 |
| InChI | InChI=1S/C21H29N3/c1-24(2)20-14-13-17(15-20)16-21(18-9-5-3-6-10-18)23-22-19-11-7-4-8-12-19/h3,5-6,9-10,14-15,21,23H,4,7-8,11-13,16H2,1-2H3 |
| InChIKey | NDXUPRAXFIBKKG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|