C11H11IO4S2 — CID 90761518
2-(3-iodophenyl)-6,7-dihydro-5H-1,4-dithiepine 1,1,4,4-tetraoxide (PubChem CID 90761518) has the molecular formula C11H11IO4S2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-(3-iodophenyl)-6,7-dihydro-5H-1,4-dithiepine 1,1,4,4-tetraoxide.
| Compound Name | 2-(3-iodophenyl)-6,7-dihydro-5H-1,4-dithiepine 1,1,4,4-tetraoxide |
|---|---|
| PubChem CID | 90761518 |
| Molecular Formula | C11H11IO4S2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.91 |
| IUPAC Name | 2-(3-iodophenyl)-6,7-dihydro-5H-1,4-dithiepine 1,1,4,4-tetraoxide |
| SMILES | O=S1(=O)C=C(c2cccc(I)c2)S(=O)(=O)CCC1 |
| InChI | InChI=1S/C11H11IO4S2/c12-10-4-1-3-9(7-10)11-8-17(13,14)5-2-6-18(11,15)16/h1,3-4,7-8H,2,5-6H2 |
| InChIKey | MIZKTMCOOOVVCQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|