C15H13N3 — CID 90761597
9-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1,3,5,9,11,13(17),15-heptaene (PubChem CID 90761597) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 9-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1,3,5,9,11,13(17),15-heptaene.
| Compound Name | 9-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1,3,5,9,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 90761597 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 9-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1,3,5,9,11,13(17),15-heptaene |
| SMILES | CC1=c2cnc3[nH]ccc(c2=3)=C2C=CC=CC2N1 |
| InChI | InChI=1S/C15H13N3/c1-9-12-8-17-15-14(12)11(6-7-16-15)10-4-2-3-5-13(10)18-9/h2-8,13,16,18H,1H3 |
| InChIKey | GWCNXMJTZCCOFA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |