C12H16FN3O3 — CID 90761654
3-[[2-fluoro-5-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]propanoic acid (PubChem CID 90761654) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is 3-[[2-fluoro-5-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]propanoic acid.
| Compound Name | 3-[[2-fluoro-5-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 90761654 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-[[2-fluoro-5-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)Cc1cc(C(N)=NO)ccc1F |
| InChI | InChI=1S/C12H16FN3O3/c1-16(5-4-11(17)18)7-9-6-8(12(14)15-19)2-3-10(9)13/h2-3,6,19H,4-5,7H2,1H3,(H2,14,15)(H,17,18) |
| InChIKey | MHELQUUDLDWZTP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|