About N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine
N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine (PubChem CID 90761815) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine |
| PubChem CID | 90761815 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine |
| SMILES | CN(C)CCN1C2CCC1CN(C)C2 |
| InChI | InChI=1S/C11H23N3/c1-12(2)6-7-14-10-4-5-11(14)9-13(3)8-10/h10-11H,4-9H2,1-3H3 |
| InChIKey | ZTUVGCBZRDFMKY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine?
The IUPAC name of N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine (CID 90761815) is N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine.
What is the SMILES notation for N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine?
The canonical SMILES for N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine is CN(C)CCN1C2CCC1CN(C)C2.
What is the InChIKey of N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine?
The InChIKey is ZTUVGCBZRDFMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-12(2)6-7-14-10-4-5-11(14)9-13(3)8-10/h10-11H,4-9H2,1-3H3.
What are the key properties of N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine?
N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine has a molecular weight of 197.33 g/mol, XLogP of 0.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanamine is sourced from PubChem (CID 90761815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).