C32H30N4O2 — CID 90761844
7-amino-4-[3-(5-tert-butyl-1-hydroxyisoindol-2-yl)-2-methylphenyl]-9H-carbazole-1-carboxamide (PubChem CID 90761844) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 7-amino-4-[3-(5-tert-butyl-1-hydroxyisoindol-2-yl)-2-methylphenyl]-9H-carbazole-1-carboxamide.
| Compound Name | 7-amino-4-[3-(5-tert-butyl-1-hydroxyisoindol-2-yl)-2-methylphenyl]-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 90761844 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 7-amino-4-[3-(5-tert-butyl-1-hydroxyisoindol-2-yl)-2-methylphenyl]-9H-carbazole-1-carboxamide |
| SMILES | Cc1c(-c2ccc(C(N)=O)c3[nH]c4cc(N)ccc4c23)cccc1-n1cc2cc(C(C)(C)C)ccc2c1O |
| InChI | InChI=1S/C32H30N4O2/c1-17-21(23-12-13-25(30(34)37)29-28(23)24-11-9-20(33)15-26(24)35-29)6-5-7-27(17)36-16-18-14-19(32(2,3)4)8-10-22(18)31(36)38/h5-16,35,38H,33H2,1-4H3,(H2,34,37) |
| InChIKey | SOIRIHXRSOEZDM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|