C35H39N3O — CID 90761877
3-[[4-(3,3-diphenylpropyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)benzamide (PubChem CID 90761877) has the molecular formula C35H39N3O and a molecular weight of 517.72 g/mol. Its IUPAC name is 3-[[4-(3,3-diphenylpropyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[4-(3,3-diphenylpropyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 90761877 |
| Molecular Formula | C35H39N3O |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 3-[[4-(3,3-diphenylpropyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(CN2CCN(CCC(c3ccccc3)c3ccccc3)CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C35H39N3O/c1-28(30-13-5-2-6-14-30)36-35(39)33-19-11-12-29(26-33)27-38-24-22-37(23-25-38)21-20-34(31-15-7-3-8-16-31)32-17-9-4-10-18-32/h2-19,26,28,34H,20-25,27H2,1H3,(H,36,39) |
| InChIKey | JBJSLNUEMGTSON-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |