C21H24N4O6 — CID 90761949
N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enoylamino]methyl]prop-2-enamide (PubChem CID 90761949) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enoylamino]methyl]prop-2-enamide.
| Compound Name | N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enoylamino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 90761949 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-N-[[(2,5-dihydroxy-1-prop-2-enylpyrrol-3-yl)-prop-2-enoylamino]methyl]prop-2-enamide |
| SMILES | C=CCn1c(O)cc(N(CN(C(=O)C=C)c2cc(O)n(CC=C)c2O)C(=O)C=C)c1O |
| InChI | InChI=1S/C21H24N4O6/c1-5-9-22-18(28)11-14(20(22)30)24(16(26)7-3)13-25(17(27)8-4)15-12-19(29)23(10-6-2)21(15)31/h5-8,11-12,28-31H,1-4,9-10,13H2 |
| InChIKey | NALVLBGJIGZTNA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|