About 2,3,6,7-tetrafluorooctane
2,3,6,7-tetrafluorooctane (PubChem CID 90762432) has the molecular formula C8H14F4
and a molecular weight of 186.19 g/mol. Its IUPAC name is 2,3,6,7-tetrafluorooctane.
Molecular Properties
| Compound Name | 2,3,6,7-tetrafluorooctane |
| PubChem CID | 90762432 |
| Molecular Formula | C8H14F4 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2,3,6,7-tetrafluorooctane |
| SMILES | CC(F)C(F)CCC(F)C(C)F |
| InChI | InChI=1S/C8H14F4/c1-5(9)7(11)3-4-8(12)6(2)10/h5-8H,3-4H2,1-2H3 |
| InChIKey | RDBIKPKLJOPQMK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3,6,7-tetrafluorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6,7-tetrafluorooctane?
The IUPAC name of 2,3,6,7-tetrafluorooctane (CID 90762432) is 2,3,6,7-tetrafluorooctane.
What is the SMILES notation for 2,3,6,7-tetrafluorooctane?
The canonical SMILES for 2,3,6,7-tetrafluorooctane is CC(F)C(F)CCC(F)C(C)F.
What is the InChIKey of 2,3,6,7-tetrafluorooctane?
The InChIKey is RDBIKPKLJOPQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F4/c1-5(9)7(11)3-4-8(12)6(2)10/h5-8H,3-4H2,1-2H3.
What are the key properties of 2,3,6,7-tetrafluorooctane?
2,3,6,7-tetrafluorooctane has a molecular weight of 186.19 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6,7-tetrafluorooctane is sourced from PubChem (CID 90762432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).