C28H42N2O10 — CID 90762646
benzene-1,4-diamine;2,5-bis[2-(2-propoxyethoxy)ethoxy]terephthalic acid (PubChem CID 90762646) has the molecular formula C28H42N2O10 and a molecular weight of 566.65 g/mol. Its IUPAC name is benzene-1,4-diamine;2,5-bis[2-(2-propoxyethoxy)ethoxy]terephthalic acid.
| Compound Name | benzene-1,4-diamine;2,5-bis[2-(2-propoxyethoxy)ethoxy]terephthalic acid |
|---|---|
| PubChem CID | 90762646 |
| Molecular Formula | C28H42N2O10 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | benzene-1,4-diamine;2,5-bis[2-(2-propoxyethoxy)ethoxy]terephthalic acid |
| SMILES | CCCOCCOCCOc1cc(C(=O)O)c(OCCOCCOCCC)cc1C(=O)O.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C22H34O10.C6H8N2/c1-3-5-27-7-9-29-11-13-31-19-15-18(22(25)26)20(16-17(19)21(23)24)32-14-12-30-10-8-28-6-4-2;7-5-1-2-6(8)4-3-5/h15-16H,3-14H2,1-2H3,(H,23,24)(H,25,26);1-4H,7-8H2 |
| InChIKey | HIZGQWWIMTYZPZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|