C26H40O2 — CID 90763273
methyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tricyclo[5.2.1.02,6]decane (PubChem CID 90763273) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is methyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tricyclo[5.2.1.02,6]decane.
| Compound Name | methyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 90763273 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | methyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.COC(=O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C16H24O2.C10H16/c1-7-8(2)11-6-10(7)14-9-4-12(15(11)14)13(5-9)16(17)18-3;1-2-9-7-4-5-8(6-7)10(9)3-1/h7-15H,4-6H2,1-3H3;7-10H,1-6H2 |
| InChIKey | XERGTHQGDWFUJJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|