C16H24Cl2O — CID 90763444
10,10-dichloro-3,7,7,11-tetramethyl-2-oxatetracyclo[6.5.0.01,3.09,11]tridecane (PubChem CID 90763444) has the molecular formula C16H24Cl2O and a molecular weight of 303.27 g/mol. Its IUPAC name is 10,10-dichloro-3,7,7,11-tetramethyl-2-oxatetracyclo[6.5.0.01,3.09,11]tridecane.
| Compound Name | 10,10-dichloro-3,7,7,11-tetramethyl-2-oxatetracyclo[6.5.0.01,3.09,11]tridecane |
|---|---|
| PubChem CID | 90763444 |
| Molecular Formula | C16H24Cl2O |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 10,10-dichloro-3,7,7,11-tetramethyl-2-oxatetracyclo[6.5.0.01,3.09,11]tridecane |
| SMILES | CC1(C)CCCC2(C)OC23CCC2(C)C(C13)C2(Cl)Cl |
| InChI | InChI=1S/C16H24Cl2O/c1-12(2)6-5-7-14(4)15(19-14)9-8-13(3)11(10(12)15)16(13,17)18/h10-11H,5-9H2,1-4H3 |
| InChIKey | MVZPCEZZYOVDEC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|