C21H43NO3 — CID 90763470
11-[bis(2-hydroxyethyl)amino]-7-ethyl-4,4,9,9-tetramethylundec-6-en-2-ol (PubChem CID 90763470) has the molecular formula C21H43NO3 and a molecular weight of 357.58 g/mol. Its IUPAC name is 11-[bis(2-hydroxyethyl)amino]-7-ethyl-4,4,9,9-tetramethylundec-6-en-2-ol.
| Compound Name | 11-[bis(2-hydroxyethyl)amino]-7-ethyl-4,4,9,9-tetramethylundec-6-en-2-ol |
|---|---|
| PubChem CID | 90763470 |
| Molecular Formula | C21H43NO3 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.32 |
| IUPAC Name | 11-[bis(2-hydroxyethyl)amino]-7-ethyl-4,4,9,9-tetramethylundec-6-en-2-ol |
| SMILES | CCC(=CCC(C)(C)CC(C)O)CC(C)(C)CCN(CCO)CCO |
| InChI | InChI=1S/C21H43NO3/c1-7-19(8-9-20(3,4)16-18(2)25)17-21(5,6)10-11-22(12-14-23)13-15-24/h8,18,23-25H,7,9-17H2,1-6H3 |
| InChIKey | ZVJRUXANQSFLGD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|