C17H19N7O2 — CID 90763598
5-(2-amino-1,3-benzoxazole-5-carboximidoyl)-4-N-(oxan-4-yl)pyrimidine-4,6-diamine (PubChem CID 90763598) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 5-(2-amino-1,3-benzoxazole-5-carboximidoyl)-4-N-(oxan-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-(2-amino-1,3-benzoxazole-5-carboximidoyl)-4-N-(oxan-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 90763598 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-(2-amino-1,3-benzoxazole-5-carboximidoyl)-4-N-(oxan-4-yl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc2oc(N)nc2c1)c1c(N)ncnc1NC1CCOCC1 |
| InChI | InChI=1S/C17H19N7O2/c18-14(9-1-2-12-11(7-9)24-17(20)26-12)13-15(19)21-8-22-16(13)23-10-3-5-25-6-4-10/h1-2,7-8,10,18H,3-6H2,(H2,20,24)(H3,19,21,22,23)/b18-14+ |
| InChIKey | YDDUORQKJTUHFF-NBVRZTHBSA-N |
| XLogP | 1.79 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|