C4H3I2NO2 — CID 90763766
1,3-diiodopyrrole-2,5-diol (PubChem CID 90763766) has the molecular formula C4H3I2NO2 and a molecular weight of 350.88 g/mol. Its IUPAC name is 1,3-diiodopyrrole-2,5-diol.
| Compound Name | 1,3-diiodopyrrole-2,5-diol |
|---|---|
| PubChem CID | 90763766 |
| Molecular Formula | C4H3I2NO2 |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.83 |
| IUPAC Name | 1,3-diiodopyrrole-2,5-diol |
| SMILES | Oc1cc(I)c(O)n1I |
| InChI | InChI=1S/C4H3I2NO2/c5-2-1-3(8)7(6)4(2)9/h1,8-9H |
| InChIKey | PUDYVFSEQFACAB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|