C23H28FN3O4S — CID 90763868
tert-butyl 6-ethyl-5-fluoro-2-[5-(propan-2-ylsulfamoyl)-2-pyridinyl]indole-1-carboxylate (PubChem CID 90763868) has the molecular formula C23H28FN3O4S and a molecular weight of 461.56 g/mol. Its IUPAC name is tert-butyl 6-ethyl-5-fluoro-2-[5-(propan-2-ylsulfamoyl)-2-pyridinyl]indole-1-carboxylate.
| Compound Name | tert-butyl 6-ethyl-5-fluoro-2-[5-(propan-2-ylsulfamoyl)-2-pyridinyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 90763868 |
| Molecular Formula | C23H28FN3O4S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | tert-butyl 6-ethyl-5-fluoro-2-[5-(propan-2-ylsulfamoyl)-2-pyridinyl]indole-1-carboxylate |
| SMILES | CCc1cc2c(cc1F)cc(-c1ccc(S(=O)(=O)NC(C)C)cn1)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28FN3O4S/c1-7-15-11-20-16(10-18(15)24)12-21(27(20)22(28)31-23(4,5)6)19-9-8-17(13-25-19)32(29,30)26-14(2)3/h8-14,26H,7H2,1-6H3 |
| InChIKey | XEVLKRRHEFYFLP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |