C29H32N6O3 — CID 90764209
4-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(6-methyl-1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 90764209) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is 4-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(6-methyl-1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(6-methyl-1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90764209 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 4-[[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(6-methyl-1H-indol-3-yl)ethyl]amino]methyl]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1[nH]ncc1CN(CCc1c[nH]c2cc(C)ccc12)C1CCc2cc(C=CC(=O)NO)ccc21 |
| InChI | InChI=1S/C29H32N6O3/c1-18-3-7-23-21(15-31-25(23)13-18)11-12-35(17-22-16-32-33-28(22)29(37)30-2)26-9-6-20-14-19(4-8-24(20)26)5-10-27(36)34-38/h3-5,7-8,10,13-16,26,31,38H,6,9,11-12,17H2,1-2H3,(H,30,37)(H,32,33)(H,34,36) |
| InChIKey | ZAVZSARUHSTSLC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|