C17H30N2O2S — CID 90764281
4-(methylamino)-N,N-bis(3-methylbutyl)benzenesulfonamide (PubChem CID 90764281) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 4-(methylamino)-N,N-bis(3-methylbutyl)benzenesulfonamide.
| Compound Name | 4-(methylamino)-N,N-bis(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90764281 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-(methylamino)-N,N-bis(3-methylbutyl)benzenesulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)N(CCC(C)C)CCC(C)C)cc1 |
| InChI | InChI=1S/C17H30N2O2S/c1-14(2)10-12-19(13-11-15(3)4)22(20,21)17-8-6-16(18-5)7-9-17/h6-9,14-15,18H,10-13H2,1-5H3 |
| InChIKey | YTDWDAZVTZNAAB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |