C25H36F3NO5 — CID 90764886
methyl 7-[(1R,2R,5S)-5-hydroxy-3-(hydroxyamino)-2-[(3R)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]hept-4-enoate (PubChem CID 90764886) has the molecular formula C25H36F3NO5 and a molecular weight of 487.56 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-5-hydroxy-3-(hydroxyamino)-2-[(3R)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]hept-4-enoate.
| Compound Name | methyl 7-[(1R,2R,5S)-5-hydroxy-3-(hydroxyamino)-2-[(3R)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 90764886 |
| Molecular Formula | C25H36F3NO5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-5-hydroxy-3-(hydroxyamino)-2-[(3R)-3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentyl]cyclopentyl]hept-4-enoate |
| SMILES | COC(=O)CCC=CCC[C@H]1[C@@H](O)CC(NO)[C@@H]1CC[C@@H](O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H36F3NO5/c1-34-24(32)10-5-3-2-4-9-21-20(22(29-33)16-23(21)31)14-13-19(30)12-11-17-7-6-8-18(15-17)25(26,27)28/h2-3,6-8,15,19-23,29-31,33H,4-5,9-14,16H2,1H3/t19-,20+,21+,22?,23-/m0/s1 |
| InChIKey | DQVXLFJBXPIWRA-QLYHNFIXSA-N |
| XLogP | 4.41 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|