C28H40O4 — CID 90765227
5-[(3R)-3-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylideneoxolan-2-one (PubChem CID 90765227) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 5-[(3R)-3-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylideneoxolan-2-one.
| Compound Name | 5-[(3R)-3-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 90765227 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 5-[(3R)-3-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1CC(CC[C@@H](C)[C@H]2CCC3C(=CC=C4C[C@@H](O)C[C@H](O)C4=C)CCC[C@@]32C)OC1=O |
| InChI | InChI=1S/C28H40O4/c1-17(7-10-23-14-18(2)27(31)32-23)24-11-12-25-20(6-5-13-28(24,25)4)8-9-21-15-22(29)16-26(30)19(21)3/h8-9,17,22-26,29-30H,2-3,5-7,10-16H2,1,4H3/t17-,22-,23?,24-,25?,26+,28-/m1/s1 |
| InChIKey | ODCAUHMULFAHFV-ZRWYXVDQSA-N |
| XLogP | 5.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|