C24H33F2NO9S — CID 90765401
8-(oxan-2-yloxy)octyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate (PubChem CID 90765401) has the molecular formula C24H33F2NO9S and a molecular weight of 549.59 g/mol. Its IUPAC name is 8-(oxan-2-yloxy)octyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate.
| Compound Name | 8-(oxan-2-yloxy)octyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 90765401 |
| Molecular Formula | C24H33F2NO9S |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 8-(oxan-2-yloxy)octyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
| SMILES | O=C(OCCCCCCCCOC1CCCCO1)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C24H33F2NO9S/c25-24(26,23(30)35-14-7-4-2-1-3-6-12-33-18-9-5-8-13-34-18)37(31,32)36-27-21(28)19-16-10-11-17(15-16)20(19)22(27)29/h10-11,16-18,28-29H,1-9,12-15H2 |
| InChIKey | UFHYRDHWTIIMPJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|