C20H22N2O2S — CID 90766086
3-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 90766086) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90766086 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-[5-methyl-2-(4-methylphenyl)-1,3-thiazol-4-yl]-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(-c2nc(C3C(=O)NC4(CCCCC4)C3=O)c(C)s2)cc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-12-6-8-14(9-7-12)19-21-16(13(2)25-19)15-17(23)20(22-18(15)24)10-4-3-5-11-20/h6-9,15H,3-5,10-11H2,1-2H3,(H,22,24) |
| InChIKey | WFPXZDMVSVBPKS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|