About 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane
1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane (PubChem CID 90766244) has the molecular formula C12H21-
and a molecular weight of 165.30 g/mol. Its IUPAC name is 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane.
Molecular Properties
| Compound Name | 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane |
| PubChem CID | 90766244 |
| Molecular Formula | C12H21- |
| Molecular Weight | 165.30 g/mol |
| Exact Mass | 165.16 |
| IUPAC Name | 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane |
| SMILES | CCC(C)C1CC1C1(C)[CH-]C1C |
| InChI | InChI=1S/C12H21/c1-5-8(2)10-6-11(10)12(4)7-9(12)3/h7-11H,5-6H2,1-4H3/q-1 |
| InChIKey | FKNQLWJTSVNTTK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane?
The IUPAC name of 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane (CID 90766244) is 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane.
What is the SMILES notation for 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane?
The canonical SMILES for 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane is CCC(C)C1CC1C1(C)[CH-]C1C.
What is the InChIKey of 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane?
The InChIKey is FKNQLWJTSVNTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21/c1-5-8(2)10-6-11(10)12(4)7-9(12)3/h7-11H,5-6H2,1-4H3/q-1.
What are the key properties of 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane?
1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane has a molecular weight of 165.30 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butan-2-ylcyclopropyl)-1,2-dimethylcyclopropane is sourced from PubChem (CID 90766244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).