C22H33N5O2 — CID 90766313
5-ethyl-N-methyl-6-(2-methyl-6-morpholin-4-yl-3-pyridinyl)-3-pentoxypyrazin-2-amine (PubChem CID 90766313) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 5-ethyl-N-methyl-6-(2-methyl-6-morpholin-4-yl-3-pyridinyl)-3-pentoxypyrazin-2-amine.
| Compound Name | 5-ethyl-N-methyl-6-(2-methyl-6-morpholin-4-yl-3-pyridinyl)-3-pentoxypyrazin-2-amine |
|---|---|
| PubChem CID | 90766313 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 5-ethyl-N-methyl-6-(2-methyl-6-morpholin-4-yl-3-pyridinyl)-3-pentoxypyrazin-2-amine |
| SMILES | CCCCCOc1nc(CC)c(-c2ccc(N3CCOCC3)nc2C)nc1NC |
| InChI | InChI=1S/C22H33N5O2/c1-5-7-8-13-29-22-21(23-4)26-20(18(6-2)25-22)17-9-10-19(24-16(17)3)27-11-14-28-15-12-27/h9-10H,5-8,11-15H2,1-4H3,(H,23,26) |
| InChIKey | QEGMOZBDTIDROA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|