C30H62O6Si2 — CID 90766471
tert-butyl-[(3R,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5R)-6-ethyl-4-methoxy-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-4-yl]oxy-dimethylsilane (PubChem CID 90766471) has the molecular formula C30H62O6Si2 and a molecular weight of 574.99 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5R)-6-ethyl-4-methoxy-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5R)-6-ethyl-4-methoxy-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 90766471 |
| Molecular Formula | C30H62O6Si2 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | tert-butyl-[(3R,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2R,4S,5R)-6-ethyl-4-methoxy-3,5-dimethyloxan-2-yl]oxymethyl]-5,6-dimethyloxan-4-yl]oxy-dimethylsilane |
| SMILES | CCC1O[C@@H](OCC2O[C@@H](C)C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C(C)[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C30H62O6Si2/c1-17-23-20(3)25(31-12)21(4)28(34-23)32-18-24-27(36-38(15,16)30(9,10)11)26(19(2)22(5)33-24)35-37(13,14)29(6,7)8/h19-28H,17-18H2,1-16H3/t19?,20-,21?,22+,23?,24?,25+,26-,27-,28-/m1/s1 |
| InChIKey | CNVBQFHAOOGKMB-MWSCWMOSSA-N |
| XLogP | 7.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|