C14H17F3N2O4 — CID 9076650
(3S)-4,4,4-trifluoro-3-hydroxy-N,3-dimethyl-N-[(1R)-1-(3-nitrophenyl)ethyl]butanamide (PubChem CID 9076650) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-hydroxy-N,3-dimethyl-N-[(1R)-1-(3-nitrophenyl)ethyl]butanamide.
| Compound Name | (3S)-4,4,4-trifluoro-3-hydroxy-N,3-dimethyl-N-[(1R)-1-(3-nitrophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 9076650 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-hydroxy-N,3-dimethyl-N-[(1R)-1-(3-nitrophenyl)ethyl]butanamide |
| SMILES | C[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=O)C[C@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O4/c1-9(10-5-4-6-11(7-10)19(22)23)18(3)12(20)8-13(2,21)14(15,16)17/h4-7,9,21H,8H2,1-3H3/t9-,13+/m1/s1 |
| InChIKey | OAIFQUOTUWKMJD-RNCFNFMXSA-N |
| XLogP | 2.82 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|