About 1-oxacyclononadeca-10,12,14-triene-2,5-dione
1-oxacyclononadeca-10,12,14-triene-2,5-dione (PubChem CID 90766571) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-oxacyclononadeca-10,12,14-triene-2,5-dione.
Molecular Properties
| Compound Name | 1-oxacyclononadeca-10,12,14-triene-2,5-dione |
| PubChem CID | 90766571 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-oxacyclononadeca-10,12,14-triene-2,5-dione |
| SMILES | O=C1CCCCC=CC=CC=CCCCCOC(=O)CC1 |
| InChI | InChI=1S/C18H26O3/c19-17-13-11-9-7-5-3-1-2-4-6-8-10-12-16-21-18(20)15-14-17/h1-6H,7-16H2 |
| InChIKey | QRQWDWWOKXKGPM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxacyclononadeca-10,12,14-triene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxacyclononadeca-10,12,14-triene-2,5-dione?
The IUPAC name of 1-oxacyclononadeca-10,12,14-triene-2,5-dione (CID 90766571) is 1-oxacyclononadeca-10,12,14-triene-2,5-dione.
What is the SMILES notation for 1-oxacyclononadeca-10,12,14-triene-2,5-dione?
The canonical SMILES for 1-oxacyclononadeca-10,12,14-triene-2,5-dione is O=C1CCCCC=CC=CC=CCCCCOC(=O)CC1.
What is the InChIKey of 1-oxacyclononadeca-10,12,14-triene-2,5-dione?
The InChIKey is QRQWDWWOKXKGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c19-17-13-11-9-7-5-3-1-2-4-6-8-10-12-16-21-18(20)15-14-17/h1-6H,7-16H2.
What are the key properties of 1-oxacyclononadeca-10,12,14-triene-2,5-dione?
1-oxacyclononadeca-10,12,14-triene-2,5-dione has a molecular weight of 290.40 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxacyclononadeca-10,12,14-triene-2,5-dione is sourced from PubChem (CID 90766571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).