C20H20N2O5 — CID 90766711
(4aS,8aS,9S)-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-8a,9-dihydro-6H-benzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 90766711) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is (4aS,8aS,9S)-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-8a,9-dihydro-6H-benzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | (4aS,8aS,9S)-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-8a,9-dihydro-6H-benzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 90766711 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (4aS,8aS,9S)-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-8a,9-dihydro-6H-benzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | CN(C)[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@@]2(O)C(=O)CC=C[C@@H]12 |
| InChI | InChI=1S/C20H20N2O5/c1-22(2)16-13-9-6-10-14(23)20(13,25)18(24)15-17(16)27-21-19(15)26-11-12-7-4-3-5-8-12/h3-9,13,16,25H,10-11H2,1-2H3/t13-,16-,20-/m0/s1 |
| InChIKey | KWIYPFCYFQAKRK-RISOHXOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|