About 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole
3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole (PubChem CID 90767009) has the molecular formula C19H17Cl2NO2
and a molecular weight of 362.26 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole |
| PubChem CID | 90767009 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole |
| SMILES | CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccccc1 |
| InChI | InChI=1S/C19H17Cl2NO2/c1-12(2)19-14(11-23-13-7-4-3-5-8-13)18(22-24-19)17-15(20)9-6-10-16(17)21/h3-10,12H,11H2,1-2H3 |
| InChIKey | CZCDHWYBLWNFID-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole?
The IUPAC name of 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole (CID 90767009) is 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole?
The canonical SMILES for 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole is CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccccc1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole?
The InChIKey is CZCDHWYBLWNFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2NO2/c1-12(2)19-14(11-23-13-7-4-3-5-8-13)18(22-24-19)17-15(20)9-6-10-16(17)21/h3-10,12H,11H2,1-2H3.
What are the key properties of 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole?
3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole has a molecular weight of 362.26 g/mol, XLogP of 6.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-4-(phenoxymethyl)-5-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 90767009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).