About 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol
2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol (PubChem CID 90767233) has the molecular formula C15H17F2NOS
and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol |
| PubChem CID | 90767233 |
| Molecular Formula | C15H17F2NOS |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol |
| SMILES | CCN(CCO)c1csc(Cc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C15H17F2NOS/c1-2-18(6-7-19)12-9-13(20-10-12)8-11-4-3-5-14(16)15(11)17/h3-5,9-10,19H,2,6-8H2,1H3 |
| InChIKey | XTPMZTQKSLHOLQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol?
The IUPAC name of 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol (CID 90767233) is 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol.
What is the SMILES notation for 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol?
The canonical SMILES for 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol is CCN(CCO)c1csc(Cc2cccc(F)c2F)c1.
What is the InChIKey of 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol?
The InChIKey is XTPMZTQKSLHOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NOS/c1-2-18(6-7-19)12-9-13(20-10-12)8-11-4-3-5-14(16)15(11)17/h3-5,9-10,19H,2,6-8H2,1H3.
What are the key properties of 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol?
2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol has a molecular weight of 297.37 g/mol, XLogP of 3.44, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(2,3-difluorophenyl)methyl]thiophen-3-yl]-ethylamino]ethanol is sourced from PubChem (CID 90767233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).