C20H34O2 — CID 90767403
ethane;6-(hydroperoxymethyl)-2,2,3,3,4,4,5-heptamethyl-1H-naphthalene (PubChem CID 90767403) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;6-(hydroperoxymethyl)-2,2,3,3,4,4,5-heptamethyl-1H-naphthalene.
| Compound Name | ethane;6-(hydroperoxymethyl)-2,2,3,3,4,4,5-heptamethyl-1H-naphthalene |
|---|---|
| PubChem CID | 90767403 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | ethane;6-(hydroperoxymethyl)-2,2,3,3,4,4,5-heptamethyl-1H-naphthalene |
| SMILES | CC.Cc1c(COO)ccc2c1C(C)(C)C(C)(C)C(C)(C)C2 |
| InChI | InChI=1S/C18H28O2.C2H6/c1-12-14(11-20-19)9-8-13-10-16(2,3)18(6,7)17(4,5)15(12)13;1-2/h8-9,19H,10-11H2,1-7H3;1-2H3 |
| InChIKey | UYJGFIUBVPOYQN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|