About ethane;2-methylquinoxaline
ethane;2-methylquinoxaline (PubChem CID 90767427) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is ethane;2-methylquinoxaline.
Molecular Properties
| Compound Name | ethane;2-methylquinoxaline |
| PubChem CID | 90767427 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | ethane;2-methylquinoxaline |
| SMILES | CC.CC.CC.Cc1cnc2ccccc2n1 |
| InChI | InChI=1S/C9H8N2.3C2H6/c1-7-6-10-8-4-2-3-5-9(8)11-7;3*1-2/h2-6H,1H3;3*1-2H3 |
| InChIKey | YUWTZYALWZTBAV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylquinoxaline?
The IUPAC name of ethane;2-methylquinoxaline (CID 90767427) is ethane;2-methylquinoxaline.
What is the SMILES notation for ethane;2-methylquinoxaline?
The canonical SMILES for ethane;2-methylquinoxaline is CC.CC.CC.Cc1cnc2ccccc2n1.
What is the InChIKey of ethane;2-methylquinoxaline?
The InChIKey is YUWTZYALWZTBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.3C2H6/c1-7-6-10-8-4-2-3-5-9(8)11-7;3*1-2/h2-6H,1H3;3*1-2H3.
What are the key properties of ethane;2-methylquinoxaline?
ethane;2-methylquinoxaline has a molecular weight of 234.39 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylquinoxaline is sourced from PubChem (CID 90767427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).