C27H28N4O3S — CID 90767512
(3S,5S)-5-[(2-cyanophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide (PubChem CID 90767512) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is (3S,5S)-5-[(2-cyanophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide.
| Compound Name | (3S,5S)-5-[(2-cyanophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90767512 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (3S,5S)-5-[(2-cyanophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N[C@@H]1CNC[C@@H](C(=O)NCC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H28N4O3S/c28-16-22-13-7-8-14-26(22)35(33,34)31-24-15-23(17-29-18-24)27(32)30-19-25(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-14,23-25,29,31H,15,17-19H2,(H,30,32)/t23-,24-/m0/s1 |
| InChIKey | YXCMCRSRVFNVLS-ZEQRLZLVSA-N |
| XLogP | 2.76 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |