C10H8F3NO5S — CID 90767544
trifluoromethyl 3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-4-sulfonate (PubChem CID 90767544) has the molecular formula C10H8F3NO5S and a molecular weight of 311.24 g/mol. Its IUPAC name is trifluoromethyl 3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-4-sulfonate.
| Compound Name | trifluoromethyl 3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-4-sulfonate |
|---|---|
| PubChem CID | 90767544 |
| Molecular Formula | C10H8F3NO5S |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | trifluoromethyl 3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-4-sulfonate |
| SMILES | O=S(=O)(OC(F)(F)F)n1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C10H8F3NO5S/c11-10(12,13)19-20(17,18)14-8(15)6-4-1-2-5(3-4)7(6)9(14)16/h1-2,4-5,15-16H,3H2 |
| InChIKey | KLYPMJQJDMAUOQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|