C8H11NO6 — CID 90767962
4-(2-amino-2,2-dihydroxyethyl)benzene-1,2,3,5-tetrol (PubChem CID 90767962) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-(2-amino-2,2-dihydroxyethyl)benzene-1,2,3,5-tetrol.
| Compound Name | 4-(2-amino-2,2-dihydroxyethyl)benzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 90767962 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 4-(2-amino-2,2-dihydroxyethyl)benzene-1,2,3,5-tetrol |
| SMILES | NC(O)(O)Cc1c(O)cc(O)c(O)c1O |
| InChI | InChI=1S/C8H11NO6/c9-8(14,15)2-3-4(10)1-5(11)7(13)6(3)12/h1,10-15H,2,9H2 |
| InChIKey | XAMZDXRTQZSVKT-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|