C16H29F3N4O4S — CID 90768027
N-[(5S)-5-amino-6-oxo-6-pyrrolidin-1-ylhexyl]-4-(2,2,2-trifluoroethylsulfonylamino)butanamide (PubChem CID 90768027) has the molecular formula C16H29F3N4O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-pyrrolidin-1-ylhexyl]-4-(2,2,2-trifluoroethylsulfonylamino)butanamide.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-pyrrolidin-1-ylhexyl]-4-(2,2,2-trifluoroethylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 90768027 |
| Molecular Formula | C16H29F3N4O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-pyrrolidin-1-ylhexyl]-4-(2,2,2-trifluoroethylsulfonylamino)butanamide |
| SMILES | N[C@@H](CCCCNC(=O)CCCNS(=O)(=O)CC(F)(F)F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H29F3N4O4S/c17-16(18,19)12-28(26,27)22-9-5-7-14(24)21-8-2-1-6-13(20)15(25)23-10-3-4-11-23/h13,22H,1-12,20H2,(H,21,24)/t13-/m0/s1 |
| InChIKey | SMAMVGGCPQTKTA-ZDUSSCGKSA-N |
| XLogP | 0.48 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|