C11H11F2NO4 — CID 90768112
2,6-difluoro-4-(oxiran-2-ylmethyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione (PubChem CID 90768112) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2,6-difluoro-4-(oxiran-2-ylmethyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione.
| Compound Name | 2,6-difluoro-4-(oxiran-2-ylmethyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
|---|---|
| PubChem CID | 90768112 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,6-difluoro-4-(oxiran-2-ylmethyl)-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
| SMILES | O=C1C2C(F)C3OC3C(F)C2C(=O)N1CC1CO1 |
| InChI | InChI=1S/C11H11F2NO4/c12-6-4-5(7(13)9-8(6)18-9)11(16)14(10(4)15)1-3-2-17-3/h3-9H,1-2H2 |
| InChIKey | UGQXNPFPJKRXQC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|