About 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole
3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole (PubChem CID 90768268) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole.
Analyze 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole?
The IUPAC name of 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole (CID 90768268) is 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole.
What is the SMILES notation for 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole?
The canonical SMILES for 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole is C1N=NC2CNCC12.
What is the InChIKey of 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole?
The InChIKey is DHAFZAJGOWCOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-4-2-7-8-5(4)3-6-1/h4-6H,1-3H2.
What are the key properties of 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole?
3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole has a molecular weight of 111.15 g/mol, XLogP of 0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 90768268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).