C16H23NO4 — CID 90769130
4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3,5-dimethylbenzamide (PubChem CID 90769130) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3,5-dimethylbenzamide.
| Compound Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 90769130 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(C)c1OCC1COC(C)(C)OC1 |
| InChI | InChI=1S/C16H23NO4/c1-10-5-13(15(17)18)6-11(2)14(10)19-7-12-8-20-16(3,4)21-9-12/h5-6,12H,7-9H2,1-4H3,(H2,17,18) |
| InChIKey | CXXPDBPERAOVEO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |