C21H24NO7PS — CID 90769198
ethyl-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenoxy]phosphinic acid (PubChem CID 90769198) has the molecular formula C21H24NO7PS and a molecular weight of 465.46 g/mol. Its IUPAC name is ethyl-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenoxy]phosphinic acid.
| Compound Name | ethyl-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 90769198 |
| Molecular Formula | C21H24NO7PS |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | ethyl-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenoxy]phosphinic acid |
| SMILES | CCP(=O)(O)Oc1cc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)sn2)ccc1OC |
| InChI | InChI=1S/C21H24NO7PS/c1-6-30(23,24)29-17-9-13(7-8-16(17)25-2)15-12-20(31-22-15)14-10-18(26-3)21(28-5)19(11-14)27-4/h7-12H,6H2,1-5H3,(H,23,24) |
| InChIKey | WHFFHNGFJXWSQG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|