C13H23N — CID 90769228
4-methyl-6-(3-methylpent-4-enyl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 90769228) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 4-methyl-6-(3-methylpent-4-enyl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 4-methyl-6-(3-methylpent-4-enyl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 90769228 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4-methyl-6-(3-methylpent-4-enyl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | C=CC(C)CCC1=CC(C)CCNC1 |
| InChI | InChI=1S/C13H23N/c1-4-11(2)5-6-13-9-12(3)7-8-14-10-13/h4,9,11-12,14H,1,5-8,10H2,2-3H3 |
| InChIKey | IFHNXAZSSHTGOQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|