C5H5ClN2S2 — CID 90769300
6-chloro-3,4-dihydro-2H-thieno[3,2-e][1,2,4]thiadiazine (PubChem CID 90769300) has the molecular formula C5H5ClN2S2 and a molecular weight of 192.70 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-2H-thieno[3,2-e][1,2,4]thiadiazine.
| Compound Name | 6-chloro-3,4-dihydro-2H-thieno[3,2-e][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 90769300 |
| Molecular Formula | C5H5ClN2S2 |
| Molecular Weight | 192.70 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | 6-chloro-3,4-dihydro-2H-thieno[3,2-e][1,2,4]thiadiazine |
| SMILES | Clc1cc2c(s1)SNCN2 |
| InChI | InChI=1S/C5H5ClN2S2/c6-4-1-3-5(9-4)10-8-2-7-3/h1,7-8H,2H2 |
| InChIKey | TUKWAPNRCICFAR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|