C11H21N3O — CID 90769866
6-[[(3-aminocyclobutyl)methylamino]methyl]-3,6-dihydro-2H-pyran-3-amine (PubChem CID 90769866) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 6-[[(3-aminocyclobutyl)methylamino]methyl]-3,6-dihydro-2H-pyran-3-amine.
| Compound Name | 6-[[(3-aminocyclobutyl)methylamino]methyl]-3,6-dihydro-2H-pyran-3-amine |
|---|---|
| PubChem CID | 90769866 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 6-[[(3-aminocyclobutyl)methylamino]methyl]-3,6-dihydro-2H-pyran-3-amine |
| SMILES | NC1C=CC(CNCC2CC(N)C2)OC1 |
| InChI | InChI=1S/C11H21N3O/c12-9-1-2-11(15-7-9)6-14-5-8-3-10(13)4-8/h1-2,8-11,14H,3-7,12-13H2 |
| InChIKey | DNLLMKCMTLGGAA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|