About N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole
N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole (PubChem CID 90770094) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole.
Molecular Properties
| Compound Name | N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole |
| PubChem CID | 90770094 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole |
| SMILES | CC.CC(=O)N=C(N)N.CN1C=CC2C=CC=CC21 |
| InChI | InChI=1S/C9H11N.C3H7N3O.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-2(7)6-3(4)5;1-2/h2-9H,1H3;1H3,(H4,4,5,6,7);1-2H3 |
| InChIKey | LCPNICXOFWDBBX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole?
The IUPAC name of N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole (CID 90770094) is N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole.
What is the SMILES notation for N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole?
The canonical SMILES for N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole is CC.CC(=O)N=C(N)N.CN1C=CC2C=CC=CC21.
What is the InChIKey of N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole?
The InChIKey is LCPNICXOFWDBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C3H7N3O.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-2(7)6-3(4)5;1-2/h2-9H,1H3;1H3,(H4,4,5,6,7);1-2H3.
What are the key properties of N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole?
N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole has a molecular weight of 264.37 g/mol, XLogP of 1.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)acetamide;ethane;1-methyl-3a,7a-dihydroindole is sourced from PubChem (CID 90770094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).