About but-1-ene;2-methylbut-1-ene
but-1-ene;2-methylbut-1-ene (PubChem CID 90770104) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is but-1-ene;2-methylbut-1-ene.
Molecular Properties
| Compound Name | but-1-ene;2-methylbut-1-ene |
| PubChem CID | 90770104 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | but-1-ene;2-methylbut-1-ene |
| SMILES | C=C(C)CC.C=CCC |
| InChI | InChI=1S/C5H10.C4H8/c1-4-5(2)3;1-3-4-2/h2,4H2,1,3H3;3H,1,4H2,2H3 |
| InChIKey | PRWZSSOCGJNJGS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;2-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;2-methylbut-1-ene?
The IUPAC name of but-1-ene;2-methylbut-1-ene (CID 90770104) is but-1-ene;2-methylbut-1-ene.
What is the SMILES notation for but-1-ene;2-methylbut-1-ene?
The canonical SMILES for but-1-ene;2-methylbut-1-ene is C=C(C)CC.C=CCC.
What is the InChIKey of but-1-ene;2-methylbut-1-ene?
The InChIKey is PRWZSSOCGJNJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.C4H8/c1-4-5(2)3;1-3-4-2/h2,4H2,1,3H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;2-methylbut-1-ene?
but-1-ene;2-methylbut-1-ene has a molecular weight of 126.24 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;2-methylbut-1-ene is sourced from PubChem (CID 90770104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).