C10H10F8O3 — CID 90770114
3,3,4,4-tetrafluoro-4-[1,1,2-trifluoro-1-(1-fluoroethenoxy)but-3-en-2-yl]oxybutan-2-ol (PubChem CID 90770114) has the molecular formula C10H10F8O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-4-[1,1,2-trifluoro-1-(1-fluoroethenoxy)but-3-en-2-yl]oxybutan-2-ol.
| Compound Name | 3,3,4,4-tetrafluoro-4-[1,1,2-trifluoro-1-(1-fluoroethenoxy)but-3-en-2-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 90770114 |
| Molecular Formula | C10H10F8O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3,3,4,4-tetrafluoro-4-[1,1,2-trifluoro-1-(1-fluoroethenoxy)but-3-en-2-yl]oxybutan-2-ol |
| SMILES | C=CC(F)(OC(F)(F)C(F)(F)C(C)O)C(F)(F)OC(=C)F |
| InChI | InChI=1S/C10H10F8O3/c1-4-7(12,9(15,16)20-6(3)11)21-10(17,18)8(13,14)5(2)19/h4-5,19H,1,3H2,2H3 |
| InChIKey | QPHCZVNZZJEOHA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|