About 4,4-dimethoxy-3,5-diphenylpyrazolidine
4,4-dimethoxy-3,5-diphenylpyrazolidine (PubChem CID 90770156) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4,4-dimethoxy-3,5-diphenylpyrazolidine.
Molecular Properties
| Compound Name | 4,4-dimethoxy-3,5-diphenylpyrazolidine |
| PubChem CID | 90770156 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4,4-dimethoxy-3,5-diphenylpyrazolidine |
| SMILES | COC1(OC)C(c2ccccc2)NNC1c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-20-17(21-2)15(13-9-5-3-6-10-13)18-19-16(17)14-11-7-4-8-12-14/h3-12,15-16,18-19H,1-2H3 |
| InChIKey | KZGKMEACFFKAKA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxy-3,5-diphenylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxy-3,5-diphenylpyrazolidine?
The IUPAC name of 4,4-dimethoxy-3,5-diphenylpyrazolidine (CID 90770156) is 4,4-dimethoxy-3,5-diphenylpyrazolidine.
What is the SMILES notation for 4,4-dimethoxy-3,5-diphenylpyrazolidine?
The canonical SMILES for 4,4-dimethoxy-3,5-diphenylpyrazolidine is COC1(OC)C(c2ccccc2)NNC1c1ccccc1.
What is the InChIKey of 4,4-dimethoxy-3,5-diphenylpyrazolidine?
The InChIKey is KZGKMEACFFKAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-20-17(21-2)15(13-9-5-3-6-10-13)18-19-16(17)14-11-7-4-8-12-14/h3-12,15-16,18-19H,1-2H3.
What are the key properties of 4,4-dimethoxy-3,5-diphenylpyrazolidine?
4,4-dimethoxy-3,5-diphenylpyrazolidine has a molecular weight of 284.36 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxy-3,5-diphenylpyrazolidine is sourced from PubChem (CID 90770156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).