C28H23FN2O4 — CID 90770372
4-[2-(3-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90770372) has the molecular formula C28H23FN2O4 and a molecular weight of 470.50 g/mol. Its IUPAC name is 4-[2-(3-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 4-[2-(3-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90770372 |
| Molecular Formula | C28H23FN2O4 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 4-[2-(3-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(CCOc4cccc(F)c4)CCC3(C)O2)c2ccccc12 |
| InChI | InChI=1S/C28H23FN2O4/c1-27-12-13-28(35-27,14-15-34-18-7-5-6-17(29)16-18)24-23(27)25(32)31(26(24)33)22-11-10-21(30-2)19-8-3-4-9-20(19)22/h3-11,16,32-33H,12-15H2,1H3 |
| InChIKey | AZCJADMKKNVIQS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|