C25H30N2O2S — CID 90770429
4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 90770429) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 90770429 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | COc1ccc(Cc2[nH]c(=S)[nH]c2O)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H30N2O2S/c1-24(2)10-11-25(3,4)19-14-16(7-8-18(19)24)17-12-15(6-9-21(17)29-5)13-20-22(28)27-23(30)26-20/h6-9,12,14,28H,10-11,13H2,1-5H3,(H2,26,27,30) |
| InChIKey | FRYCQBMJBMVTTM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|